Your phone isn't dirty - it's chemically clingy
- ACS BCP
- 7 days ago
- 3 min read
We touch our phones 100+ times a day. 10 seconds later it looks like a fingerprint museum but behind it all is the science of surface energy, the invisible molecular carpets called oleophobic coatings, and surfactants

The Invisible Teflon Carpet
Phone glass is not left bare. Phone companies coat the glass with a monolayer of fluorosilane molecules using condensation, whereby Si-OH from the glass and Si-OCH from the molecule react to form the coating. The structure formed in this case is a self-assembled monolayer wherein the fluorocarbon tails protrude outward from the glass surface, acting as small non-stick bristles. Since carbon-fluorine bonds are highly non-polar and low-energy bonds, water and oils cannot react with them effectively, resulting in beading of oil and water on the phone.
The molecule has 3 parts:
1. Silane head: Si-O-CH3 groups that react with glass. Reaction: Si-OH (glass) + Si-OCH3 (coating) → Si-O-Si (bond) + CH3OH. This covalently bonds the coating to glass.
2. Spacer: A short carbon chain.
3. Tail: A perfluorocarbon chain, like -CF2-CF3.
This leads to the creation of an oleophobic coating.
Why Smearing Makes It Worse
That smear is sebum, the oily mixture your skin secretes to stay moisturized.
Chemically it's mostly composed of:

Triglycerides: CH2(OOC-R)CH(OOC-R)CH2(OOC-R) where R = fatty acid chains
Wax esters: R-COO-R'
Squalene: C3 H50, a long hydrocarbon
These are all non-polar long hydrocarbon chains held together by weak London dispersion forces. They don't mix with water because water is polar: O-H bonds create partial charges + on H and ð- on O. This is the age-old rule: "like dissolves like". By touching the screen, you deposit this non-polar substance on those parts where the coating has rubbed off. On pure glass, which has a high surface energy, the substance will spread out. On the coating, it will bead.
On smearing, it is done using our t-shirts which are normally made from cotton and polyester; that is, polymers of cellulose and PET. These are solids, non-polar and do not have any solvent ability on sebum.
In wiping, we do not dissolve the oil film. We rather use shear force that allows the oil to be smeared on a thin layer on the surface of the screen. This explains the appearance of the streaks and hence why it looks bad. In wiping, we are also physically abrading the SAM fluorosilane layer.
The Fix And Why It Works
the two real solutions: isopropyl alcohol and soap + water.
1) Isopropyl alcohol (IPA) CH3-CH(OH)-CH3 is amphiphilic: it has a non-polar propyl group and a polar OH group.
Mechanism:
1. IPA dissolves in the sebum because of the non-polar part.
2. The polar OH group interacts with water and evaporates.
3. It reduces the surface tension of the oil, letting it lift off the surface.
70% IPA is better than 99% because water helps swell and lift the oil. Pure IPA evaporates too fast and can leave streaks.
2) Soap works differently: Example: Sodium lauryl sulfate
CH(CH2)11OSO₃Na

Structure: Hydrophobic tail + hydrophilic head.
Mechanism:
In water, surfactants form micelles. The hydrophobic tails point inward, trapping oil. The hydrophilic heads face water.
Oil droplet + micelle → Oil trapped inside micelle → Rinsed away
That's why hand soap removes fingerprints better than just water
Conclusion:
Daily cleaning reveals chemistry due to surface energy and micelles being put into play, hence next time when the screen is oily, you will know exactly what is going on. The oily stains on the phone result from the sebum which sticks on the screen after the invisible layer called the fluorosilane coating wears out, and all that the shirt does is smear the sebum.
By Jay Thakkar,
F. Y. B. Pharm.




Comments